Datasets:
SMILES string | Y int64 | Assay_ID string | RegressionProperty float64 | LogRegressionProperty float64 | Relation string |
|---|---|---|---|---|---|
C(#Cc1ccc2ccccc2n1)c1cncnc1 | 0 | CHEMBL2345734 | 22.45 | 7.648784 | = |
Fc1cnc(C#Cc2ccc3ccccc3n2)nc1 | 0 | CHEMBL2345734 | 15.59 | 7.807154 | = |
FC(F)(F)c1ccnc(C#Cc2ccc3ccccc3n2)n1 | 0 | CHEMBL2345734 | 15.87 | 7.799423 | = |
C(#Cc1ncccn1)c1ccc2ccccc2n1 | 0 | CHEMBL2345734 | 28.63 | 7.543179 | = |
COc1cccc(C#Cc2ccc3ccccc3n2)n1 | 0 | CHEMBL2345734 | 48.62 | 7.313185 | = |
Fc1cccc(C#Cc2ccc3ccccc3n2)n1 | 0 | CHEMBL2345734 | 46.9 | 7.328827 | = |
N#Cc1cccc(C#Cc2ccc3ccccc3n2)n1 | 1 | CHEMBL2345734 | 64.82 | 7.188291 | = |
FC(F)(F)c1cccc(C#Cc2ccc3ccccc3n2)n1 | 0 | CHEMBL2345734 | 28.66 | 7.542724 | = |
Cc1ccc(C#Cc2ccc3ccccc3n2)nc1 | 1 | CHEMBL2345734 | 66.27 | 7.178683 | = |
Fc1ccc(C#Cc2ccc3ccccc3n2)nc1 | 1 | CHEMBL2345734 | 63.29 | 7.198665 | = |
FC(F)(F)c1ccc(C#Cc2ccc3ccccc3n2)nc1 | 1 | CHEMBL2345734 | 50.66 | 7.295335 | = |
Cc1ccnc(C#Cc2ccc3ccccc3n2)c1 | 1 | CHEMBL2345734 | 66.48 | 7.177309 | = |
N#Cc1ccnc(C#Cc2ccc3ccccc3n2)c1 | 1 | CHEMBL2345734 | 76.09 | 7.118672 | = |
FC(F)(F)c1ccnc(C#Cc2ccc3ccccc3n2)c1 | 1 | CHEMBL2345734 | 58.04 | 7.236273 | = |
Cc1cccnc1C#Cc1ccc2ccccc2n1 | 0 | CHEMBL2345734 | 40.09 | 7.396964 | = |
Fc1cccnc1C#Cc1ccc2ccccc2n1 | 1 | CHEMBL2345734 | 55.24 | 7.257746 | = |
FC(F)(F)c1cccnc1C#Cc1ccc2ccccc2n1 | 0 | CHEMBL2345734 | 16.43 | 7.784362 | = |
Brc1cccc2nc(C#Cc3ccccn3)ccc12 | 1 | CHEMBL2345734 | 77.52 | 7.110586 | = |
Clc1cccc2nc(C#Cc3ccccn3)ccc12 | 1 | CHEMBL2345734 | 64.31 | 7.191721 | = |
Oc1cccc2nc(C#Cc3ccccn3)ccc12 | 0 | CHEMBL2345734 | 22.15 | 7.654626 | = |
CC(C)(C)C(=O)Oc1cccc2nc(C#Cc3ccccn3)ccc12 | 1 | CHEMBL2345734 | 62.44 | 7.204537 | = |
C(#Cc1ccc2ccccc2n1)c1ccccn1 | 1 | CHEMBL2345734 | 76.66 | 7.115431 | = |
Brc1cccc2nc(C#Cc3cccnc3)ccc12 | 0 | CHEMBL2345734 | 40.07 | 7.397181 | = |
Clc1cccc2nc(C#Cc3cccnc3)ccc12 | 0 | CHEMBL2345734 | 28.35 | 7.547447 | = |
Oc1cccc2nc(C#Cc3cccnc3)ccc12 | 0 | CHEMBL2345734 | 17.58 | 7.754981 | = |
CC(C)(C)C(=O)Oc1cccc2nc(C#Cc3cccnc3)ccc12 | 0 | CHEMBL2345734 | 28.5 | 7.545155 | = |
CCOc1cccc2nc(C#Cc3cccnc3)ccc12 | 1 | CHEMBL2345734 | 66.63 | 7.17633 | = |
COc1cccc2nc(C#Cc3cccnc3)ccc12 | 1 | CHEMBL2345734 | 67.72 | 7.169283 | = |
C(#Cc1ccc2ccccc2n1)c1cccnc1 | 1 | CHEMBL2345734 | 65.78 | 7.181906 | = |
Brc1cccc2nc(C#Cc3ccccc3)ccc12 | 0 | CHEMBL2345734 | 20.67 | 7.68466 | = |
Clc1cccc2nc(C#Cc3ccccc3)ccc12 | 0 | CHEMBL2345734 | 8.02 | 8.095826 | = |
Oc1cccc2nc(C#Cc3ccccc3)ccc12 | 0 | CHEMBL2345734 | 24.32 | 7.614036 | = |
CC(C)(C)C(=O)Oc1cccc2nc(C#Cc3ccccc3)ccc12 | 0 | CHEMBL2345734 | 23.77 | 7.623971 | = |
COc1cccc2nc(C#Cc3ccccc3)ccc12 | 1 | CHEMBL2345734 | 68.03 | 7.1673 | = |
C(#Cc1ccc2ccccc2n1)c1ccccc1 | 1 | CHEMBL2345734 | 67.71 | 7.169347 | = |
c1csc(-c2cc(NC34CC5CC(CC(C5)C3)C4)no2)c1 | 0 | CHEMBL3772465 | 32 | 7.49485 | = |
CCCc1cc(CNC23CC4CC(CC(C4)C2)C3)no1 | 1 | CHEMBL3772465 | 73 | 7.136677 | = |
c1c(CNC23CC4CC(CC(C4)C2)C3)noc1C1CC1 | 0 | CHEMBL3772465 | 42 | 7.376751 | = |
C(NC12CC3CC(CC(C3)C1)C2)c1noc(C2CC2)n1 | 1 | CHEMBL3772465 | 82 | 7.086186 | = |
c1c(CNC23CC4CC(CC(C4)C2)C3)noc1C1CCC1 | 0 | CHEMBL3772465 | 42 | 7.376751 | = |
CC(C)c1cc(CNC23CC4CC(CC(C4)C2)C3)no1 | 1 | CHEMBL3772465 | 66 | 7.180456 | = |
c1c(CNC23CC4CC(CC(C4)C2)C3)noc1C1CCCCC1 | 1 | CHEMBL3772465 | 57 | 7.244125 | = |
c1csc(-c2nc(CNC34CC5CC(CC(C5)C3)C4)no2)c1 | 1 | CHEMBL3772465 | 66 | 7.180456 | = |
c1cc(-c2cc(CNC34CC5CC(CC(C5)C3)C4)no2)cs1 | 0 | CHEMBL3772465 | 47 | 7.327902 | = |
c1cc(-c2nc(CNC34CC5CC(CC(C5)C3)C4)no2)cs1 | 1 | CHEMBL3772465 | 74 | 7.130768 | = |
c1coc(-c2cc(CNC34CC5CC(CC(C5)C3)C4)no2)c1 | 0 | CHEMBL3772465 | 47 | 7.327902 | = |
COc1ccsc1-c1cc(CNC23CC4CC(CC(C4)C2)C3)no1 | 0 | CHEMBL3772465 | 39 | 7.408935 | = |
c1ccc(-c2cc(CNC34CC5CC(CC(C5)C3)C4)no2)cc1 | 0 | CHEMBL3772465 | 26 | 7.585027 | = |
Clc1ccccc1-c1cc(CNC23CC4CC(CC(C4)C2)C3)no1 | 1 | CHEMBL3772465 | 84 | 7.075721 | = |
Clc1ccccc1-c1nc(CNC23CC4CC(CC(C4)C2)C3)no1 | 1 | CHEMBL3772465 | 88 | 7.055517 | = |
Fc1cccc(F)c1-c1cc(CNC23CC4CC(CC(C4)C2)C3)no1 | 0 | CHEMBL3772465 | 56 | 7.251812 | = |
COc1ccc(-c2cc(CNC34CC5CC(CC(C5)C3)C4)no2)cc1 | 1 | CHEMBL3772465 | 59 | 7.229148 | = |
COc1ccc(-c2nc(CNC34CC5CC(CC(C5)C3)C4)no2)cc1 | 1 | CHEMBL3772465 | 92 | 7.036212 | = |
COc1cccc(-c2cc(CNC34CC5CC(CC(C5)C3)C4)no2)c1 | 0 | CHEMBL3772465 | 39 | 7.408935 | = |
COc1ccccc1-c1nc(CNC23CC4CC(CC(C4)C2)C3)no1 | 1 | CHEMBL3772465 | 66 | 7.180456 | = |
COc1ccc(-c2nc(CNC34CC5CC(CC(C5)C3)C4)no2)c(OC)c1 | 1 | CHEMBL3772465 | 76 | 7.119186 | = |
c1csc(-c2nnc(CNC34CC5CC(CC(C5)C3)C4)s2)c1 | 0 | CHEMBL3772465 | 39 | 7.408935 | = |
O=C1C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2 | 0 | CHEMBL3772465 | 31 | 7.508638 | = |
OC1C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2 | 0 | CHEMBL3772465 | 10 | 8 | = |
CC1(O)C2CC3CC1CC(NCc1cc(-c4cccs4)on1)(C3)C2 | 0 | CHEMBL3772465 | 27 | 7.568636 | = |
c1csc(-c2cc(CNC34CC5CC(C3)C3(CO3)C(C5)C4)no2)c1 | 1 | CHEMBL3772465 | 72 | 7.142668 | = |
c1csc(-c2cc(CNC34CC5COC(CC(C5)C3)C4)no2)c1 | 1 | CHEMBL3772465 | 58 | 7.236572 | = |
OC12CC3CC(C1)CC(NCc1cc(-c4cccs4)on1)(C3)C2 | 0 | CHEMBL3772465 | 40 | 7.39794 | = |
COc1ccsc1-c1cc(CNC23CC4CC(CC(O)(C4)C2)C3)no1 | 0 | CHEMBL3772465 | 33 | 7.481486 | = |
OC12CC3CC(O)(C1)CC(NCc1cc(-c4cccs4)on1)(C3)C2 | 1 | CHEMBL3772465 | 69 | 7.161151 | = |
CN(C)CCNC(=O)c1ccc(Cl)c2cc3ccccc3nc12 | 1 | CHEMBL701039 | 33 | 7.481486 | = |
O=C(NCCNCCO)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 240 | 6.619789 | = |
CN(C)CCNC(=O)c1cccc2c(N)c3ccccc3nc12 | 1 | CHEMBL701039 | 15 | 7.823909 | = |
Cc1ccc2cc3cccc(C(=O)NCCN(C)C)c3nc2c1 | 1 | CHEMBL701039 | 121 | 6.917215 | = |
COc1cccc2nc3c(C(=O)NCCN(C)C)cccc3cc12 | 1 | CHEMBL701039 | 58 | 7.236572 | = |
Cc1cccc2cc3cccc(C(=O)NCCN(C)C)c3nc12 | 1 | CHEMBL701039 | 4.3 | 8.366532 | = |
Cc1c2ccccc2nc2c(C(=O)NCCN(C)C)cccc12 | 1 | CHEMBL701039 | 150 | 6.823909 | = |
CN(C)CCCCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 450 | 6.346787 | = |
Cc1ccc(C(=O)NCCN(C)C)c2nc3ccccc3cc12 | 1 | CHEMBL701039 | 37 | 7.431798 | = |
COc1ccc(C(=O)NCCN(C)C)c2nc3ccccc3cc12 | 1 | CHEMBL701039 | 8.8 | 8.055517 | = |
CN(C)CCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 370 | 6.431798 | = |
CNCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 240 | 6.619789 | = |
CN(C)CCNC(=O)c1ccc2cc3ccccc3nc2c1 | 1 | CHEMBL701039 | 8,100 | 5.091515 | = |
Cc1cccc2nc3c(C(=O)NCCN(C)C)cccc3cc12 | 1 | CHEMBL701039 | 140 | 6.853872 | = |
CN(C)CCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 105 | 6.978811 | = |
CN(C)CCCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 160 | 6.79588 | = |
CN(C)CCNC(=O)c1cc(Cl)cc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 31 | 7.508638 | = |
COc1ccc2nc3c(C(=O)NCCN(C)C)cccc3cc2c1 | 1 | CHEMBL701039 | 640 | 6.19382 | = |
COc1cccc2cc3cccc(C(=O)NCCN(C)C)c3nc12 | 1 | CHEMBL701039 | 12 | 7.920819 | = |
NCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 275 | 6.560667 | = |
COc1ccc2cc3cccc(C(=O)NCCN(C)C)c3nc2c1 | 1 | CHEMBL701039 | 210 | 6.677781 | = |
Cc1cc(C(=O)NCCN(C)C)c2nc3ccccc3cc2c1 | 1 | CHEMBL701039 | 130 | 6.886057 | = |
Cc1ccc2cc3ccccc3nc2c1C(=O)NCCN(C)C | 0 | CHEMBL701039 | 12,700 | 4.896196 | = |
COc1cc(C(=O)NCCN(C)C)c2nc3ccccc3cc2c1 | 1 | CHEMBL701039 | 30 | 7.522879 | = |
Cc1ccc2nc3c(C(=O)NCCN(C)C)cccc3cc2c1 | 1 | CHEMBL701039 | 200 | 6.69897 | = |
CN(C)CCNC(=O)c1cccc2cc3cc(Cl)ccc3nc12 | 1 | CHEMBL701039 | 250 | 6.60206 | = |
CN(C)CCNC(=O)c1cccc2cc3ccc(Cl)cc3nc12 | 1 | CHEMBL701039 | 6.4 | 8.19382 | = |
CN(C)CCNC(=O)c1cccc2cc3c(Cl)cccc3nc12 | 1 | CHEMBL701039 | 160 | 6.79588 | = |
CN(C)CCCCCCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 550 | 6.259637 | = |
CCN(CC)CCNC(=O)c1cccc2cc3ccccc3nc12 | 1 | CHEMBL701039 | 630 | 6.200659 | = |
CN(C)CCNC(=O)c1cccc2cc3cccc(Cl)c3nc12 | 1 | CHEMBL701039 | 6.9 | 8.161151 | = |
CN(C)CCNC(=O)c1cccc2nc3ccccc3cc12 | 0 | CHEMBL701039 | 17,900 | 4.747147 | = |
CN(C)CCNC(=O)c1ccc2nc3ccccc3cc2c1 | 1 | CHEMBL701039 | 9,300 | 5.031517 | = |
Cn1c(SSc2c(C(=O)Nc3ccccc3)c3cccc(Cl)c3n2C)c(C(=O)Nc2ccccc2)c2cccc(Cl)c21 | 0 | CHEMBL843949 | 100,000 | 4 | > |
COc1cccc2c(C(=O)Nc3ccccc3)c(SSc3c(C(=O)Nc4ccccc4)c4cccc(OC)c4n3C)n(C)c12 | 1 | CHEMBL843949 | 3,600 | 5.443697 | = |
FS-Mol
FS-Mol is a dataset curated from ChEMBL27 for small molecule activity prediction. It consists of 5,120 distinct assays and includes a total of 233,786 unique compounds. This is a mirror of the Official Github repo where the dataset was uploaded in 2021.
Preprocessing
[Update 2025.08.16 Version 1.1.0] We removed invalid SMILES strings from the dataset, which could not be parsed by RDKit.
- Train split: removed 12470 strings from 5038727 strings
- Test split: removed 127 strings from 56220 strings
- Validation split: removed 18 strings from 19008 strings
We utilized the raw data uploaded on Github and performed several preprocessing:
- Sanitize the molecules using RDKit and MolVS (standardize SMILES format)
- Formatting (Combine jsonl.gz files to one csv/parquet file)
- Rename the columns ('Property' to 'Y')
- Convert the floats in 'Y' column to integers
- Split the dataset (train, test, validation)
If you would like to try our pre-processing steps, run our script.
Quickstart Usage
Load a dataset in python
Each subset can be loaded into python using the Huggingface datasets library.
First, from the command line install the datasets library
$ pip install datasets
then, from within python load the datasets library
>>> import datasets
and load the FSMol datasets, e.g.,
>>> FSMol = datasets.load_dataset("maomlab/FSMol", name = "FSMol")
train-00000-of-00001.parquet: 100%|ββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 152M/152M [00:03<00:00, 39.4MB/s]
test-00000-of-00001.parquet: 100%|βββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 1.54M/1.54M [00:00<00:00, 33.3MB/s]
validation-00000-of-00001.parquet: 100%|βββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 517k/517k [00:00<00:00, 52.6MB/s]
Generating train split: 100%|ββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 5038727/5038727 [00:08<00:00, 600413.56 examples/s]
Generating test split: 100%|βββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 56220/56220 [00:00<00:00, 974722.00 examples/s]
Generating validation split: 100%|βββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββββ| 19008/19008 [00:00<00:00, 871143.71 examples/s]
and inspecting the loaded dataset
>>> FSMol
DatasetDict({
train: Dataset({
features: ['SMILES', 'Y', 'Assay_ID', 'RegressionProperty', 'LogRegressionProperty', 'Relation'],
num_rows: 5026257
})
test: Dataset({
features: ['SMILES', 'Y', 'Assay_ID', 'RegressionProperty', 'LogRegressionProperty', 'Relation'],
num_rows: 56093
})
validation: Dataset({
features: ['SMILES', 'Y', 'Assay_ID', 'RegressionProperty', 'LogRegressionProperty', 'Relation'],
num_rows: 18990
})
})
Use a dataset to train a model
One way to use the dataset is through the MolFlux package developed by Exscientia.
First, from the command line, install MolFlux library with catboost and rdkit support
pip install 'molflux[catboost,rdkit]'
then load, featurize, split, fit, and evaluate the catboost model
import json
from datasets import load_dataset
from molflux.datasets import featurise_dataset
from molflux.features import load_from_dicts as load_representations_from_dicts
from molflux.splits import load_from_dict as load_split_from_dict
from molflux.modelzoo import load_from_dict as load_model_from_dict
from molflux.metrics import load_suite
Split and evaluate the catboost model
split_dataset = load_dataset('maomlab/FSMol', name = 'FSMol')
split_featurised_dataset = featurise_dataset(
split_dataset,
column = "SMILES",
representations = load_representations_from_dicts([{"name": "morgan"}, {"name": "maccs_rdkit"}]))
model = load_model_from_dict({
"name": "cat_boost_classifier",
"config": {
"x_features": ['SMILES::morgan', 'SMILES::maccs_rdkit'],
"y_features": ['Y']}})
model.train(split_featurised_dataset["train"])
preds = model.predict(split_featurised_dataset["test"])
classification_suite = load_suite("classification")
scores = classification_suite.compute(
references=split_featurised_dataset["test"]['Y'],
predictions=preds["cat_boost_classifier::Y"])
Citation
@article{stanley2021fs, title={FS-Mol: A Few-Shot Learning Dataset of Molecules}, author={Stanley, Matthew and Ramsundar, Bharath and Kearnes, Steven and Riley, Patrick}, journal={NeurIPS 2021 AI for Science Workshop}, year={2021}, url={https://www.microsoft.com/en-us/research/publication/fs-mol-a-few-shot-learning-dataset-of-molecules/
- Downloads last month
- 39